C31H49N5O4S2 — CID 143940581
N-[2-(3,4-dihydroxyphenyl)ethyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide;ethane;2-(2-methyl-1,3-thiazol-4-yl)-N-(2-piperidin-1-ylethyl)acetamide (PubChem CID 143940581) has the molecular formula C31H49N5O4S2 and a molecular weight of 619.90 g/mol. Its IUPAC name is N-[2-(3,4-dihydroxyphenyl)ethyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide;ethane;2-(2-methyl-1,3-thiazol-4-yl)-N-(2-piperidin-1-ylethyl)acetamide.
| Compound Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide;ethane;2-(2-methyl-1,3-thiazol-4-yl)-N-(2-piperidin-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 143940581 |
| Molecular Formula | C31H49N5O4S2 |
| Molecular Weight | 619.90 g/mol |
| Exact Mass | 619.32 |
| IUPAC Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide;ethane;2-(2-methyl-1,3-thiazol-4-yl)-N-(2-piperidin-1-ylethyl)acetamide |
| SMILES | CC.CC.Cc1nc(CC(=O)NCCN2CCCCC2)cs1.Cc1nc(CC(=O)NCCc2ccc(O)c(O)c2)cs1 |
| InChI | InChI=1S/C14H16N2O3S.C13H21N3OS.2C2H6/c1-9-16-11(8-20-9)7-14(19)15-5-4-10-2-3-12(17)13(18)6-10;1-11-15-12(10-18-11)9-13(17)14-5-8-16-6-3-2-4-7-16;2*1-2/h2-3,6,8,17-18H,4-5,7H2,1H3,(H,15,19);10H,2-9H2,1H3,(H,14,17);2*1-2H3 |
| InChIKey | HACDPTGQDOCYDO-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.90 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|