C13H23N3O2 — CID 143940615
N-butyl-2-(2-methyl-6-oxo-1H-pyrimidin-5-yl)acetamide;ethane (PubChem CID 143940615) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is N-butyl-2-(2-methyl-6-oxo-1H-pyrimidin-5-yl)acetamide;ethane.
| Compound Name | N-butyl-2-(2-methyl-6-oxo-1H-pyrimidin-5-yl)acetamide;ethane |
|---|---|
| PubChem CID | 143940615 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | N-butyl-2-(2-methyl-6-oxo-1H-pyrimidin-5-yl)acetamide;ethane |
| SMILES | CC.CCCCNC(=O)Cc1cnc(C)[nH]c1=O |
| InChI | InChI=1S/C11H17N3O2.C2H6/c1-3-4-5-12-10(15)6-9-7-13-8(2)14-11(9)16;1-2/h7H,3-6H2,1-2H3,(H,12,15)(H,13,14,16);1-2H3 |
| InChIKey | USHKLLZRHMHHOY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|