C14H18ClN3OS — CID 143940637
N-[(6-chloro-3-pyridinyl)methyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide;ethane (PubChem CID 143940637) has the molecular formula C14H18ClN3OS and a molecular weight of 311.84 g/mol. Its IUPAC name is N-[(6-chloro-3-pyridinyl)methyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide;ethane.
| Compound Name | N-[(6-chloro-3-pyridinyl)methyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide;ethane |
|---|---|
| PubChem CID | 143940637 |
| Molecular Formula | C14H18ClN3OS |
| Molecular Weight | 311.84 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-[(6-chloro-3-pyridinyl)methyl]-2-(2-methyl-1,3-thiazol-4-yl)acetamide;ethane |
| SMILES | CC.Cc1nc(CC(=O)NCc2ccc(Cl)nc2)cs1 |
| InChI | InChI=1S/C12H12ClN3OS.C2H6/c1-8-16-10(7-18-8)4-12(17)15-6-9-2-3-11(13)14-5-9;1-2/h2-3,5,7H,4,6H2,1H3,(H,15,17);1-2H3 |
| InChIKey | IZKCIFLOJMEYKU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.84 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|