About 2-[(2Z)-2-ethylidenehydrazinyl]-N,3-dimethylbut-2-enamide
2-[(2Z)-2-ethylidenehydrazinyl]-N,3-dimethylbut-2-enamide (PubChem CID 143941273) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is 2-[(2Z)-2-ethylidenehydrazinyl]-N,3-dimethylbut-2-enamide.
Molecular Properties
| Compound Name | 2-[(2Z)-2-ethylidenehydrazinyl]-N,3-dimethylbut-2-enamide |
| PubChem CID | 143941273 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 2-[(2Z)-2-ethylidenehydrazinyl]-N,3-dimethylbut-2-enamide |
| SMILES | C/C=N\NC(C(=O)NC)=C(C)C |
| InChI | InChI=1S/C8H15N3O/c1-5-10-11-7(6(2)3)8(12)9-4/h5,11H,1-4H3,(H,9,12)/b10-5- |
| InChIKey | KVAVDJPRGYQTCA-YHYXMXQVSA-N |
| XLogP | 0.62 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2Z)-2-ethylidenehydrazinyl]-N,3-dimethylbut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2Z)-2-ethylidenehydrazinyl]-N,3-dimethylbut-2-enamide?
The IUPAC name of 2-[(2Z)-2-ethylidenehydrazinyl]-N,3-dimethylbut-2-enamide (CID 143941273) is 2-[(2Z)-2-ethylidenehydrazinyl]-N,3-dimethylbut-2-enamide.
What is the SMILES notation for 2-[(2Z)-2-ethylidenehydrazinyl]-N,3-dimethylbut-2-enamide?
The canonical SMILES for 2-[(2Z)-2-ethylidenehydrazinyl]-N,3-dimethylbut-2-enamide is C/C=N\NC(C(=O)NC)=C(C)C.
What is the InChIKey of 2-[(2Z)-2-ethylidenehydrazinyl]-N,3-dimethylbut-2-enamide?
The InChIKey is KVAVDJPRGYQTCA-YHYXMXQVSA-N. The full InChI is InChI=1S/C8H15N3O/c1-5-10-11-7(6(2)3)8(12)9-4/h5,11H,1-4H3,(H,9,12)/b10-5-.
What are the key properties of 2-[(2Z)-2-ethylidenehydrazinyl]-N,3-dimethylbut-2-enamide?
2-[(2Z)-2-ethylidenehydrazinyl]-N,3-dimethylbut-2-enamide has a molecular weight of 169.23 g/mol, XLogP of 0.62, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2Z)-2-ethylidenehydrazinyl]-N,3-dimethylbut-2-enamide is sourced from PubChem (CID 143941273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).