About 2-fluoro-4-(2-sulfanyl-1,2,4-triazol-3-yl)benzamide
2-fluoro-4-(2-sulfanyl-1,2,4-triazol-3-yl)benzamide (PubChem CID 143941398) has the molecular formula C9H7FN4OS
and a molecular weight of 238.25 g/mol. Its IUPAC name is 2-fluoro-4-(2-sulfanyl-1,2,4-triazol-3-yl)benzamide.
Molecular Properties
| Compound Name | 2-fluoro-4-(2-sulfanyl-1,2,4-triazol-3-yl)benzamide |
| PubChem CID | 143941398 |
| Molecular Formula | C9H7FN4OS |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 2-fluoro-4-(2-sulfanyl-1,2,4-triazol-3-yl)benzamide |
| SMILES | NC(=O)c1ccc(-c2ncnn2S)cc1F |
| InChI | InChI=1S/C9H7FN4OS/c10-7-3-5(1-2-6(7)8(11)15)9-12-4-13-14(9)16/h1-4,16H,(H2,11,15) |
| InChIKey | CRXRUOAAMSBFCG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-4-(2-sulfanyl-1,2,4-triazol-3-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-(2-sulfanyl-1,2,4-triazol-3-yl)benzamide?
The IUPAC name of 2-fluoro-4-(2-sulfanyl-1,2,4-triazol-3-yl)benzamide (CID 143941398) is 2-fluoro-4-(2-sulfanyl-1,2,4-triazol-3-yl)benzamide.
What is the SMILES notation for 2-fluoro-4-(2-sulfanyl-1,2,4-triazol-3-yl)benzamide?
The canonical SMILES for 2-fluoro-4-(2-sulfanyl-1,2,4-triazol-3-yl)benzamide is NC(=O)c1ccc(-c2ncnn2S)cc1F.
What is the InChIKey of 2-fluoro-4-(2-sulfanyl-1,2,4-triazol-3-yl)benzamide?
The InChIKey is CRXRUOAAMSBFCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7FN4OS/c10-7-3-5(1-2-6(7)8(11)15)9-12-4-13-14(9)16/h1-4,16H,(H2,11,15).
What are the key properties of 2-fluoro-4-(2-sulfanyl-1,2,4-triazol-3-yl)benzamide?
2-fluoro-4-(2-sulfanyl-1,2,4-triazol-3-yl)benzamide has a molecular weight of 238.25 g/mol, XLogP of 0.88, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-(2-sulfanyl-1,2,4-triazol-3-yl)benzamide is sourced from PubChem (CID 143941398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).