C16H19Br3O — CID 14394141
2,7-dibromo-4a-(bromomethyl)-1,1-dimethyl-3,4,9,9a-tetrahydro-2H-xanthene (PubChem CID 14394141) has the molecular formula C16H19Br3O and a molecular weight of 467.04 g/mol. Its IUPAC name is 2,7-dibromo-4a-(bromomethyl)-1,1-dimethyl-3,4,9,9a-tetrahydro-2H-xanthene.
| Compound Name | 2,7-dibromo-4a-(bromomethyl)-1,1-dimethyl-3,4,9,9a-tetrahydro-2H-xanthene |
|---|---|
| PubChem CID | 14394141 |
| Molecular Formula | C16H19Br3O |
| Molecular Weight | 467.04 g/mol |
| Exact Mass | 463.90 |
| IUPAC Name | 2,7-dibromo-4a-(bromomethyl)-1,1-dimethyl-3,4,9,9a-tetrahydro-2H-xanthene |
| SMILES | CC1(C)C(Br)CCC2(CBr)Oc3ccc(Br)cc3CC21 |
| InChI | InChI=1S/C16H19Br3O/c1-15(2)13-8-10-7-11(18)3-4-12(10)20-16(13,9-17)6-5-14(15)19/h3-4,7,13-14H,5-6,8-9H2,1-2H3 |
| InChIKey | VHIWRGQDBRDIMI-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.04 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|