C17H25N5 — CID 143942032
7-butan-2-yl-N-(2,3-dimethylhexa-1,5-dien-3-yl)purin-6-amine (PubChem CID 143942032) has the molecular formula C17H25N5 and a molecular weight of 299.42 g/mol. Its IUPAC name is 7-butan-2-yl-N-(2,3-dimethylhexa-1,5-dien-3-yl)purin-6-amine.
| Compound Name | 7-butan-2-yl-N-(2,3-dimethylhexa-1,5-dien-3-yl)purin-6-amine |
|---|---|
| PubChem CID | 143942032 |
| Molecular Formula | C17H25N5 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 7-butan-2-yl-N-(2,3-dimethylhexa-1,5-dien-3-yl)purin-6-amine |
| SMILES | C=CCC(C)(Nc1ncnc2ncn(C(C)CC)c12)C(=C)C |
| InChI | InChI=1S/C17H25N5/c1-7-9-17(6,12(3)4)21-16-14-15(18-10-19-16)20-11-22(14)13(5)8-2/h7,10-11,13H,1,3,8-9H2,2,4-6H3,(H,18,19,21) |
| InChIKey | MAOUJLBGOAWDLX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|