About 1-[4-[(1S,2S)-2-chlorocyclopentyl]phenyl]hexan-1-ol
1-[4-[(1S,2S)-2-chlorocyclopentyl]phenyl]hexan-1-ol (PubChem CID 143942234) has the molecular formula C17H25ClO
and a molecular weight of 280.84 g/mol. Its IUPAC name is 1-[4-[(1S,2S)-2-chlorocyclopentyl]phenyl]hexan-1-ol.
Molecular Properties
| Compound Name | 1-[4-[(1S,2S)-2-chlorocyclopentyl]phenyl]hexan-1-ol |
| PubChem CID | 143942234 |
| Molecular Formula | C17H25ClO |
| Molecular Weight | 280.84 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-[4-[(1S,2S)-2-chlorocyclopentyl]phenyl]hexan-1-ol |
| SMILES | CCCCCC(O)c1ccc([C@@H]2CCC[C@@H]2Cl)cc1 |
| InChI | InChI=1S/C17H25ClO/c1-2-3-4-8-17(19)14-11-9-13(10-12-14)15-6-5-7-16(15)18/h9-12,15-17,19H,2-8H2,1H3/t15-,16-,17?/m0/s1 |
| InChIKey | JISPWTZEJDVWNA-PYNWJHIZSA-N |
| XLogP | 5.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.84 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(1S,2S)-2-chlorocyclopentyl]phenyl]hexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(1S,2S)-2-chlorocyclopentyl]phenyl]hexan-1-ol?
The IUPAC name of 1-[4-[(1S,2S)-2-chlorocyclopentyl]phenyl]hexan-1-ol (CID 143942234) is 1-[4-[(1S,2S)-2-chlorocyclopentyl]phenyl]hexan-1-ol.
What is the SMILES notation for 1-[4-[(1S,2S)-2-chlorocyclopentyl]phenyl]hexan-1-ol?
The canonical SMILES for 1-[4-[(1S,2S)-2-chlorocyclopentyl]phenyl]hexan-1-ol is CCCCCC(O)c1ccc([C@@H]2CCC[C@@H]2Cl)cc1.
What is the InChIKey of 1-[4-[(1S,2S)-2-chlorocyclopentyl]phenyl]hexan-1-ol?
The InChIKey is JISPWTZEJDVWNA-PYNWJHIZSA-N. The full InChI is InChI=1S/C17H25ClO/c1-2-3-4-8-17(19)14-11-9-13(10-12-14)15-6-5-7-16(15)18/h9-12,15-17,19H,2-8H2,1H3/t15-,16-,17?/m0/s1.
What are the key properties of 1-[4-[(1S,2S)-2-chlorocyclopentyl]phenyl]hexan-1-ol?
1-[4-[(1S,2S)-2-chlorocyclopentyl]phenyl]hexan-1-ol has a molecular weight of 280.84 g/mol, XLogP of 5.18, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(1S,2S)-2-chlorocyclopentyl]phenyl]hexan-1-ol is sourced from PubChem (CID 143942234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).