About 4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]-2-methylsulfanyl-6H-pyrido[4,3-d]pyrimidin-5-one
4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]-2-methylsulfanyl-6H-pyrido[4,3-d]pyrimidin-5-one (PubChem CID 143942342) has the molecular formula C11H12N6OS
and a molecular weight of 276.32 g/mol. Its IUPAC name is 4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]-2-methylsulfanyl-6H-pyrido[4,3-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]-2-methylsulfanyl-6H-pyrido[4,3-d]pyrimidin-5-one |
| PubChem CID | 143942342 |
| Molecular Formula | C11H12N6OS |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]-2-methylsulfanyl-6H-pyrido[4,3-d]pyrimidin-5-one |
| SMILES | [H]/N=C/C(=C\N)Nc1nc(SC)nc2cc[nH]c(=O)c12 |
| InChI | InChI=1S/C11H12N6OS/c1-19-11-16-7-2-3-14-10(18)8(7)9(17-11)15-6(4-12)5-13/h2-5,12H,13H2,1H3,(H,14,18)(H,15,16,17)/b6-5+,12-4+ |
| InChIKey | XUYKBRODMYYMPK-NWRYNTLESA-N |
| XLogP | 0.90 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]-2-methylsulfanyl-6H-pyrido[4,3-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]-2-methylsulfanyl-6H-pyrido[4,3-d]pyrimidin-5-one?
The IUPAC name of 4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]-2-methylsulfanyl-6H-pyrido[4,3-d]pyrimidin-5-one (CID 143942342) is 4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]-2-methylsulfanyl-6H-pyrido[4,3-d]pyrimidin-5-one.
What is the SMILES notation for 4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]-2-methylsulfanyl-6H-pyrido[4,3-d]pyrimidin-5-one?
The canonical SMILES for 4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]-2-methylsulfanyl-6H-pyrido[4,3-d]pyrimidin-5-one is [H]/N=C/C(=C\N)Nc1nc(SC)nc2cc[nH]c(=O)c12.
What is the InChIKey of 4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]-2-methylsulfanyl-6H-pyrido[4,3-d]pyrimidin-5-one?
The InChIKey is XUYKBRODMYYMPK-NWRYNTLESA-N. The full InChI is InChI=1S/C11H12N6OS/c1-19-11-16-7-2-3-14-10(18)8(7)9(17-11)15-6(4-12)5-13/h2-5,12H,13H2,1H3,(H,14,18)(H,15,16,17)/b6-5+,12-4+.
What are the key properties of 4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]-2-methylsulfanyl-6H-pyrido[4,3-d]pyrimidin-5-one?
4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]-2-methylsulfanyl-6H-pyrido[4,3-d]pyrimidin-5-one has a molecular weight of 276.32 g/mol, XLogP of 0.90, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(E)-1-amino-3-iminoprop-1-en-2-yl]amino]-2-methylsulfanyl-6H-pyrido[4,3-d]pyrimidin-5-one is sourced from PubChem (CID 143942342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).