C11H16ClNO — CID 143942674
2-chloro-N,4-dimethylbenzamide;ethane (PubChem CID 143942674) has the molecular formula C11H16ClNO and a molecular weight of 213.71 g/mol. Its IUPAC name is 2-chloro-N,4-dimethylbenzamide;ethane.
| Compound Name | 2-chloro-N,4-dimethylbenzamide;ethane |
|---|---|
| PubChem CID | 143942674 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-chloro-N,4-dimethylbenzamide;ethane |
| SMILES | CC.CNC(=O)c1ccc(C)cc1Cl |
| InChI | InChI=1S/C9H10ClNO.C2H6/c1-6-3-4-7(8(10)5-6)9(12)11-2;1-2/h3-5H,1-2H3,(H,11,12);1-2H3 |
| InChIKey | ILUFOKSSFDYWSV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |