About 6-chloro-2,3-dimethyl-1H-pyridazine
6-chloro-2,3-dimethyl-1H-pyridazine (PubChem CID 143942711) has the molecular formula C6H9ClN2
and a molecular weight of 144.60 g/mol. Its IUPAC name is 6-chloro-2,3-dimethyl-1H-pyridazine.
Molecular Properties
| Compound Name | 6-chloro-2,3-dimethyl-1H-pyridazine |
| PubChem CID | 143942711 |
| Molecular Formula | C6H9ClN2 |
| Molecular Weight | 144.60 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | 6-chloro-2,3-dimethyl-1H-pyridazine |
| SMILES | CC1=CC=C(Cl)NN1C |
| InChI | InChI=1S/C6H9ClN2/c1-5-3-4-6(7)8-9(5)2/h3-4,8H,1-2H3 |
| InChIKey | QSEDMOGJHIPIBC-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.60 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2,3-dimethyl-1H-pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2,3-dimethyl-1H-pyridazine?
The IUPAC name of 6-chloro-2,3-dimethyl-1H-pyridazine (CID 143942711) is 6-chloro-2,3-dimethyl-1H-pyridazine.
What is the SMILES notation for 6-chloro-2,3-dimethyl-1H-pyridazine?
The canonical SMILES for 6-chloro-2,3-dimethyl-1H-pyridazine is CC1=CC=C(Cl)NN1C.
What is the InChIKey of 6-chloro-2,3-dimethyl-1H-pyridazine?
The InChIKey is QSEDMOGJHIPIBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClN2/c1-5-3-4-6(7)8-9(5)2/h3-4,8H,1-2H3.
What are the key properties of 6-chloro-2,3-dimethyl-1H-pyridazine?
6-chloro-2,3-dimethyl-1H-pyridazine has a molecular weight of 144.60 g/mol, XLogP of 1.42, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2,3-dimethyl-1H-pyridazine is sourced from PubChem (CID 143942711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).