C31H43N5O3S — CID 143942943
N,5-ditert-butyl-2-[3-(6-ethyl-3-pyridinyl)-4-methylanilino]-N-(2-formamidoethyl)thiophene-3-carboxamide;formamide (PubChem CID 143942943) has the molecular formula C31H43N5O3S and a molecular weight of 565.78 g/mol. Its IUPAC name is N,5-ditert-butyl-2-[3-(6-ethyl-3-pyridinyl)-4-methylanilino]-N-(2-formamidoethyl)thiophene-3-carboxamide;formamide.
| Compound Name | N,5-ditert-butyl-2-[3-(6-ethyl-3-pyridinyl)-4-methylanilino]-N-(2-formamidoethyl)thiophene-3-carboxamide;formamide |
|---|---|
| PubChem CID | 143942943 |
| Molecular Formula | C31H43N5O3S |
| Molecular Weight | 565.78 g/mol |
| Exact Mass | 565.31 |
| IUPAC Name | N,5-ditert-butyl-2-[3-(6-ethyl-3-pyridinyl)-4-methylanilino]-N-(2-formamidoethyl)thiophene-3-carboxamide;formamide |
| SMILES | CCc1ccc(-c2cc(Nc3sc(C(C)(C)C)cc3C(=O)N(CCNC=O)C(C)(C)C)ccc2C)cn1.NC=O |
| InChI | InChI=1S/C30H40N4O2S.CH3NO/c1-9-22-13-11-21(18-32-22)24-16-23(12-10-20(24)2)33-27-25(17-26(37-27)29(3,4)5)28(36)34(30(6,7)8)15-14-31-19-35;2-1-3/h10-13,16-19,33H,9,14-15H2,1-8H3,(H,31,35);1H,(H2,2,3) |
| InChIKey | HLIVILJEHQXAGG-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.78 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|