C25H18N2O3S — CID 143943849
9,20-dimethyl-3,15-diazahexacyclo[15.7.1.02,16.04,14.06,12.021,25]pentacosa-1(24),2,4(14),5,7,10,12,15,17(25),18,20,22-dodecaene-9-sulfonic acid (PubChem CID 143943849) has the molecular formula C25H18N2O3S and a molecular weight of 426.50 g/mol. Its IUPAC name is 9,20-dimethyl-3,15-diazahexacyclo[15.7.1.02,16.04,14.06,12.021,25]pentacosa-1(24),2,4(14),5,7,10,12,15,17(25),18,20,22-dodecaene-9-sulfonic acid.
| Compound Name | 9,20-dimethyl-3,15-diazahexacyclo[15.7.1.02,16.04,14.06,12.021,25]pentacosa-1(24),2,4(14),5,7,10,12,15,17(25),18,20,22-dodecaene-9-sulfonic acid |
|---|---|
| PubChem CID | 143943849 |
| Molecular Formula | C25H18N2O3S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 9,20-dimethyl-3,15-diazahexacyclo[15.7.1.02,16.04,14.06,12.021,25]pentacosa-1(24),2,4(14),5,7,10,12,15,17(25),18,20,22-dodecaene-9-sulfonic acid |
| SMILES | Cc1ccc2c3c(cccc13)-c1nc3cc4c(cc3nc1-2)C=CC(C)(S(=O)(=O)O)C=C4 |
| InChI | InChI=1S/C25H18N2O3S/c1-14-6-7-19-22-17(14)4-3-5-18(22)23-24(19)27-21-13-16-9-11-25(2,31(28,29)30)10-8-15(16)12-20(21)26-23/h3-13H,1-2H3,(H,28,29,30) |
| InChIKey | MTROVTINCMWFTA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|