C16H21FNOS+ — CID 143944028
CID 143944028 (PubChem CID 143944028) has the molecular formula C16H21FNOS+ and a molecular weight of 294.41 g/mol.
| Compound Name | CID 143944028 |
|---|---|
| PubChem CID | 143944028 |
| Molecular Formula | C16H21FNOS+ |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | — |
| SMILES | C[C@@H](N[SH+](=O)C(C)(C)C)c1ccc(F)c2ccccc12 |
| InChI | InChI=1S/C16H20FNOS/c1-11(18-20(19)16(2,3)4)12-9-10-15(17)14-8-6-5-7-13(12)14/h5-11H,1-4H3,(H,18,19)/p+1/t11-,20?/m1/s1 |
| InChIKey | RJMPFBQNKVPTAN-UAPALYRASA-O |
| XLogP | 4.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|