C24H29N3O5 — CID 143944297
(2S,4S)-2'-amino-6-(3,4-dimethoxyphenyl)-3'-methyl-2-(propoxymethyl)spiro[2,3-dihydrochromene-4,5'-imidazole]-4'-one (PubChem CID 143944297) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is (2S,4S)-2'-amino-6-(3,4-dimethoxyphenyl)-3'-methyl-2-(propoxymethyl)spiro[2,3-dihydrochromene-4,5'-imidazole]-4'-one.
| Compound Name | (2S,4S)-2'-amino-6-(3,4-dimethoxyphenyl)-3'-methyl-2-(propoxymethyl)spiro[2,3-dihydrochromene-4,5'-imidazole]-4'-one |
|---|---|
| PubChem CID | 143944297 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | (2S,4S)-2'-amino-6-(3,4-dimethoxyphenyl)-3'-methyl-2-(propoxymethyl)spiro[2,3-dihydrochromene-4,5'-imidazole]-4'-one |
| SMILES | CCCOC[C@@H]1C[C@]2(N=C(N)N(C)C2=O)c2cc(-c3ccc(OC)c(OC)c3)ccc2O1 |
| InChI | InChI=1S/C24H29N3O5/c1-5-10-31-14-17-13-24(22(28)27(2)23(25)26-24)18-11-15(6-8-19(18)32-17)16-7-9-20(29-3)21(12-16)30-4/h6-9,11-12,17H,5,10,13-14H2,1-4H3,(H2,25,26)/t17-,24-/m0/s1 |
| InChIKey | KUDINYNZEQZGHH-XDHUDOTRSA-N |
| XLogP | 2.93 |
| TPSA | 95.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|