C23H29N3O3S — CID 143944417
(7R)-2-amino-7-(3-methoxypropyl)-3-methyl-11-(3-methylsulfanylphenyl)-6,7-dihydro-5H-8,1,3-benzoxadiazecin-4-one (PubChem CID 143944417) has the molecular formula C23H29N3O3S and a molecular weight of 427.57 g/mol. Its IUPAC name is (7R)-2-amino-7-(3-methoxypropyl)-3-methyl-11-(3-methylsulfanylphenyl)-6,7-dihydro-5H-8,1,3-benzoxadiazecin-4-one.
| Compound Name | (7R)-2-amino-7-(3-methoxypropyl)-3-methyl-11-(3-methylsulfanylphenyl)-6,7-dihydro-5H-8,1,3-benzoxadiazecin-4-one |
|---|---|
| PubChem CID | 143944417 |
| Molecular Formula | C23H29N3O3S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | (7R)-2-amino-7-(3-methoxypropyl)-3-methyl-11-(3-methylsulfanylphenyl)-6,7-dihydro-5H-8,1,3-benzoxadiazecin-4-one |
| SMILES | COCCC[C@@H]1CCC(=O)N(C)/C(N)=N/c2cc(-c3cccc(SC)c3)ccc2O1 |
| InChI | InChI=1S/C23H29N3O3S/c1-26-22(27)12-10-18(7-5-13-28-2)29-21-11-9-17(15-20(21)25-23(26)24)16-6-4-8-19(14-16)30-3/h4,6,8-9,11,14-15,18H,5,7,10,12-13H2,1-3H3,(H2,24,25)/t18-/m1/s1 |
| InChIKey | NWWKLPLHHPMMME-GOSISDBHSA-N |
| XLogP | 4.45 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|