C18H18Cl2INO2 — CID 143944715
2-[[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-iodoamino]ethane-1,1-diol (PubChem CID 143944715) has the molecular formula C18H18Cl2INO2 and a molecular weight of 478.16 g/mol. Its IUPAC name is 2-[[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-iodoamino]ethane-1,1-diol.
| Compound Name | 2-[[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-iodoamino]ethane-1,1-diol |
|---|---|
| PubChem CID | 143944715 |
| Molecular Formula | C18H18Cl2INO2 |
| Molecular Weight | 478.16 g/mol |
| Exact Mass | 476.98 |
| IUPAC Name | 2-[[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-iodoamino]ethane-1,1-diol |
| SMILES | OC(O)CN(I)[C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C18H18Cl2INO2/c19-15-7-5-11(9-16(15)20)12-6-8-17(22(21)10-18(23)24)14-4-2-1-3-13(12)14/h1-5,7,9,12,17-18,23-24H,6,8,10H2/t12-,17-/m0/s1 |
| InChIKey | GLFLMINCGRFISY-SJCJKPOMSA-N |
| XLogP | 4.92 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.16 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|