C25H27F3N2O2 — CID 143944857
methyl 3-anilino-2-[4-(trifluoromethyl)phenyl]propanoate;1-phenylethanamine (PubChem CID 143944857) has the molecular formula C25H27F3N2O2 and a molecular weight of 444.50 g/mol. Its IUPAC name is methyl 3-anilino-2-[4-(trifluoromethyl)phenyl]propanoate;1-phenylethanamine.
| Compound Name | methyl 3-anilino-2-[4-(trifluoromethyl)phenyl]propanoate;1-phenylethanamine |
|---|---|
| PubChem CID | 143944857 |
| Molecular Formula | C25H27F3N2O2 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | methyl 3-anilino-2-[4-(trifluoromethyl)phenyl]propanoate;1-phenylethanamine |
| SMILES | CC(N)c1ccccc1.COC(=O)C(CNc1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H16F3NO2.C8H11N/c1-23-16(22)15(11-21-14-5-3-2-4-6-14)12-7-9-13(10-8-12)17(18,19)20;1-7(9)8-5-3-2-4-6-8/h2-10,15,21H,11H2,1H3;2-7H,9H2,1H3 |
| InChIKey | PFKGUGVOOVAXQC-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |