C20H21F3N2O — CID 143944860
3-anilino-1-pyrrolidin-1-yl-2-[4-(trifluoromethyl)phenyl]propan-1-one (PubChem CID 143944860) has the molecular formula C20H21F3N2O and a molecular weight of 362.40 g/mol. Its IUPAC name is 3-anilino-1-pyrrolidin-1-yl-2-[4-(trifluoromethyl)phenyl]propan-1-one.
| Compound Name | 3-anilino-1-pyrrolidin-1-yl-2-[4-(trifluoromethyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 143944860 |
| Molecular Formula | C20H21F3N2O |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 3-anilino-1-pyrrolidin-1-yl-2-[4-(trifluoromethyl)phenyl]propan-1-one |
| SMILES | O=C(C(CNc1ccccc1)c1ccc(C(F)(F)F)cc1)N1CCCC1 |
| InChI | InChI=1S/C20H21F3N2O/c21-20(22,23)16-10-8-15(9-11-16)18(19(26)25-12-4-5-13-25)14-24-17-6-2-1-3-7-17/h1-3,6-11,18,24H,4-5,12-14H2 |
| InChIKey | FWIHSUKYNLDHDE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |