About 1-[(1Z)-buta-1,3-dienyl]-2-ethenylimidazole;ethane
1-[(1Z)-buta-1,3-dienyl]-2-ethenylimidazole;ethane (PubChem CID 143945087) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-[(1Z)-buta-1,3-dienyl]-2-ethenylimidazole;ethane.
Molecular Properties
| Compound Name | 1-[(1Z)-buta-1,3-dienyl]-2-ethenylimidazole;ethane |
| PubChem CID | 143945087 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1-[(1Z)-buta-1,3-dienyl]-2-ethenylimidazole;ethane |
| SMILES | C=C/C=C\n1ccnc1C=C.CC |
| InChI | InChI=1S/C9H10N2.C2H6/c1-3-5-7-11-8-6-10-9(11)4-2;1-2/h3-8H,1-2H2;1-2H3/b7-5-; |
| InChIKey | SMXFTJQDMNZBAF-YJOCEBFMSA-N |
| XLogP | 3.21 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1Z)-buta-1,3-dienyl]-2-ethenylimidazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1Z)-buta-1,3-dienyl]-2-ethenylimidazole;ethane?
The IUPAC name of 1-[(1Z)-buta-1,3-dienyl]-2-ethenylimidazole;ethane (CID 143945087) is 1-[(1Z)-buta-1,3-dienyl]-2-ethenylimidazole;ethane.
What is the SMILES notation for 1-[(1Z)-buta-1,3-dienyl]-2-ethenylimidazole;ethane?
The canonical SMILES for 1-[(1Z)-buta-1,3-dienyl]-2-ethenylimidazole;ethane is C=C/C=C\n1ccnc1C=C.CC.
What is the InChIKey of 1-[(1Z)-buta-1,3-dienyl]-2-ethenylimidazole;ethane?
The InChIKey is SMXFTJQDMNZBAF-YJOCEBFMSA-N. The full InChI is InChI=1S/C9H10N2.C2H6/c1-3-5-7-11-8-6-10-9(11)4-2;1-2/h3-8H,1-2H2;1-2H3/b7-5-;.
What are the key properties of 1-[(1Z)-buta-1,3-dienyl]-2-ethenylimidazole;ethane?
1-[(1Z)-buta-1,3-dienyl]-2-ethenylimidazole;ethane has a molecular weight of 176.26 g/mol, XLogP of 3.21, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1Z)-buta-1,3-dienyl]-2-ethenylimidazole;ethane is sourced from PubChem (CID 143945087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).