About ethane;2-[(1Z,3Z)-penta-1,3-dienyl]-1H-imidazole;hydroiodide
ethane;2-[(1Z,3Z)-penta-1,3-dienyl]-1H-imidazole;hydroiodide (PubChem CID 143945095) has the molecular formula C10H17IN2
and a molecular weight of 292.16 g/mol. Its IUPAC name is ethane;2-[(1Z,3Z)-penta-1,3-dienyl]-1H-imidazole;hydroiodide.
Molecular Properties
| Compound Name | ethane;2-[(1Z,3Z)-penta-1,3-dienyl]-1H-imidazole;hydroiodide |
| PubChem CID | 143945095 |
| Molecular Formula | C10H17IN2 |
| Molecular Weight | 292.16 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | ethane;2-[(1Z,3Z)-penta-1,3-dienyl]-1H-imidazole;hydroiodide |
| SMILES | C/C=C\C=C/c1ncc[nH]1.CC.I |
| InChI | InChI=1S/C8H10N2.C2H6.HI/c1-2-3-4-5-8-9-6-7-10-8;1-2;/h2-7H,1H3,(H,9,10);1-2H3;1H/b3-2-,5-4-;; |
| InChIKey | HVEPKMDNAMSJEK-AIDAWWJNSA-N |
| XLogP | 3.64 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.16 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-[(1Z,3Z)-penta-1,3-dienyl]-1H-imidazole;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-[(1Z,3Z)-penta-1,3-dienyl]-1H-imidazole;hydroiodide?
The IUPAC name of ethane;2-[(1Z,3Z)-penta-1,3-dienyl]-1H-imidazole;hydroiodide (CID 143945095) is ethane;2-[(1Z,3Z)-penta-1,3-dienyl]-1H-imidazole;hydroiodide.
What is the SMILES notation for ethane;2-[(1Z,3Z)-penta-1,3-dienyl]-1H-imidazole;hydroiodide?
The canonical SMILES for ethane;2-[(1Z,3Z)-penta-1,3-dienyl]-1H-imidazole;hydroiodide is C/C=C\C=C/c1ncc[nH]1.CC.I.
What is the InChIKey of ethane;2-[(1Z,3Z)-penta-1,3-dienyl]-1H-imidazole;hydroiodide?
The InChIKey is HVEPKMDNAMSJEK-AIDAWWJNSA-N. The full InChI is InChI=1S/C8H10N2.C2H6.HI/c1-2-3-4-5-8-9-6-7-10-8;1-2;/h2-7H,1H3,(H,9,10);1-2H3;1H/b3-2-,5-4-;;.
What are the key properties of ethane;2-[(1Z,3Z)-penta-1,3-dienyl]-1H-imidazole;hydroiodide?
ethane;2-[(1Z,3Z)-penta-1,3-dienyl]-1H-imidazole;hydroiodide has a molecular weight of 292.16 g/mol, XLogP of 3.64, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-[(1Z,3Z)-penta-1,3-dienyl]-1H-imidazole;hydroiodide is sourced from PubChem (CID 143945095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).