C6H6F2S — CID 143945188
2,6-difluorocyclohexa-1,5-diene-1-thiol (PubChem CID 143945188) has the molecular formula C6H6F2S and a molecular weight of 148.18 g/mol. Its IUPAC name is 2,6-difluorocyclohexa-1,5-diene-1-thiol.
| Compound Name | 2,6-difluorocyclohexa-1,5-diene-1-thiol |
|---|---|
| PubChem CID | 143945188 |
| Molecular Formula | C6H6F2S |
| Molecular Weight | 148.18 g/mol |
| Exact Mass | 148.02 |
| IUPAC Name | 2,6-difluorocyclohexa-1,5-diene-1-thiol |
| SMILES | FC1=CCCC(F)=C1S |
| InChI | InChI=1S/C6H6F2S/c7-4-2-1-3-5(8)6(4)9/h2,9H,1,3H2 |
| InChIKey | HAIKCRXTPJORON-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.18 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|