About ethane;3-methyl-2-propylsulfanyl-2,3-dihydrofuran
ethane;3-methyl-2-propylsulfanyl-2,3-dihydrofuran (PubChem CID 143945222) has the molecular formula C12H26OS
and a molecular weight of 218.41 g/mol. Its IUPAC name is ethane;3-methyl-2-propylsulfanyl-2,3-dihydrofuran.
Molecular Properties
| Compound Name | ethane;3-methyl-2-propylsulfanyl-2,3-dihydrofuran |
| PubChem CID | 143945222 |
| Molecular Formula | C12H26OS |
| Molecular Weight | 218.41 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | ethane;3-methyl-2-propylsulfanyl-2,3-dihydrofuran |
| SMILES | CC.CC.CCCSC1OC=CC1C |
| InChI | InChI=1S/C8H14OS.2C2H6/c1-3-6-10-8-7(2)4-5-9-8;2*1-2/h4-5,7-8H,3,6H2,1-2H3;2*1-2H3 |
| InChIKey | KXLBQBSMTQQCLO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-methyl-2-propylsulfanyl-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-2-propylsulfanyl-2,3-dihydrofuran?
The IUPAC name of ethane;3-methyl-2-propylsulfanyl-2,3-dihydrofuran (CID 143945222) is ethane;3-methyl-2-propylsulfanyl-2,3-dihydrofuran.
What is the SMILES notation for ethane;3-methyl-2-propylsulfanyl-2,3-dihydrofuran?
The canonical SMILES for ethane;3-methyl-2-propylsulfanyl-2,3-dihydrofuran is CC.CC.CCCSC1OC=CC1C.
What is the InChIKey of ethane;3-methyl-2-propylsulfanyl-2,3-dihydrofuran?
The InChIKey is KXLBQBSMTQQCLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14OS.2C2H6/c1-3-6-10-8-7(2)4-5-9-8;2*1-2/h4-5,7-8H,3,6H2,1-2H3;2*1-2H3.
What are the key properties of ethane;3-methyl-2-propylsulfanyl-2,3-dihydrofuran?
ethane;3-methyl-2-propylsulfanyl-2,3-dihydrofuran has a molecular weight of 218.41 g/mol, XLogP of 4.69, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-2-propylsulfanyl-2,3-dihydrofuran is sourced from PubChem (CID 143945222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).