About 4-[(2E)-2-ethenylpenta-2,4-dienoxy]piperidine
4-[(2E)-2-ethenylpenta-2,4-dienoxy]piperidine (PubChem CID 143945258) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 4-[(2E)-2-ethenylpenta-2,4-dienoxy]piperidine.
Molecular Properties
| Compound Name | 4-[(2E)-2-ethenylpenta-2,4-dienoxy]piperidine |
| PubChem CID | 143945258 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 4-[(2E)-2-ethenylpenta-2,4-dienoxy]piperidine |
| SMILES | C=C/C=C(\C=C)COC1CCNCC1 |
| InChI | InChI=1S/C12H19NO/c1-3-5-11(4-2)10-14-12-6-8-13-9-7-12/h3-5,12-13H,1-2,6-10H2/b11-5+ |
| InChIKey | XFWZRFFLEBVGBP-VZUCSPMQSA-N |
| XLogP | 2.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2E)-2-ethenylpenta-2,4-dienoxy]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2E)-2-ethenylpenta-2,4-dienoxy]piperidine?
The IUPAC name of 4-[(2E)-2-ethenylpenta-2,4-dienoxy]piperidine (CID 143945258) is 4-[(2E)-2-ethenylpenta-2,4-dienoxy]piperidine.
What is the SMILES notation for 4-[(2E)-2-ethenylpenta-2,4-dienoxy]piperidine?
The canonical SMILES for 4-[(2E)-2-ethenylpenta-2,4-dienoxy]piperidine is C=C/C=C(\C=C)COC1CCNCC1.
What is the InChIKey of 4-[(2E)-2-ethenylpenta-2,4-dienoxy]piperidine?
The InChIKey is XFWZRFFLEBVGBP-VZUCSPMQSA-N. The full InChI is InChI=1S/C12H19NO/c1-3-5-11(4-2)10-14-12-6-8-13-9-7-12/h3-5,12-13H,1-2,6-10H2/b11-5+.
What are the key properties of 4-[(2E)-2-ethenylpenta-2,4-dienoxy]piperidine?
4-[(2E)-2-ethenylpenta-2,4-dienoxy]piperidine has a molecular weight of 193.29 g/mol, XLogP of 2.05, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2E)-2-ethenylpenta-2,4-dienoxy]piperidine is sourced from PubChem (CID 143945258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).