C26H29F3N6O2S — CID 143945479
(3R)-2-ethyl-4-[[6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[(2,2,2-trifluoro-1-phenylethyl)amino]pyrimidin-4-yl]amino]butane-1,3-diol (PubChem CID 143945479) has the molecular formula C26H29F3N6O2S and a molecular weight of 546.62 g/mol. Its IUPAC name is (3R)-2-ethyl-4-[[6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[(2,2,2-trifluoro-1-phenylethyl)amino]pyrimidin-4-yl]amino]butane-1,3-diol.
| Compound Name | (3R)-2-ethyl-4-[[6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[(2,2,2-trifluoro-1-phenylethyl)amino]pyrimidin-4-yl]amino]butane-1,3-diol |
|---|---|
| PubChem CID | 143945479 |
| Molecular Formula | C26H29F3N6O2S |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | (3R)-2-ethyl-4-[[6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[(2,2,2-trifluoro-1-phenylethyl)amino]pyrimidin-4-yl]amino]butane-1,3-diol |
| SMILES | CCC(CO)[C@@H](O)CNc1nc(NC(c2ccccc2)C(F)(F)F)nc(C)c1-c1nc2c(C)nccc2s1 |
| InChI | InChI=1S/C26H29F3N6O2S/c1-4-16(13-36)18(37)12-31-23-20(24-33-21-15(3)30-11-10-19(21)38-24)14(2)32-25(35-23)34-22(26(27,28)29)17-8-6-5-7-9-17/h5-11,16,18,22,36-37H,4,12-13H2,1-3H3,(H2,31,32,34,35)/t16?,18-,22?/m0/s1 |
| InChIKey | BWUVSEOEAMEKKJ-OJCRERRGSA-N |
| XLogP | 5.27 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |