C19H26N6OS — CID 143945484
[3-[[2-amino-6-methyl-5-[4-(methyliminomethyl)-5-prop-2-enyl-1,3-thiazol-2-yl]pyrimidin-4-yl]amino]cyclopentyl]methanol (PubChem CID 143945484) has the molecular formula C19H26N6OS and a molecular weight of 386.53 g/mol. Its IUPAC name is [3-[[2-amino-6-methyl-5-[4-(methyliminomethyl)-5-prop-2-enyl-1,3-thiazol-2-yl]pyrimidin-4-yl]amino]cyclopentyl]methanol.
| Compound Name | [3-[[2-amino-6-methyl-5-[4-(methyliminomethyl)-5-prop-2-enyl-1,3-thiazol-2-yl]pyrimidin-4-yl]amino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 143945484 |
| Molecular Formula | C19H26N6OS |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | [3-[[2-amino-6-methyl-5-[4-(methyliminomethyl)-5-prop-2-enyl-1,3-thiazol-2-yl]pyrimidin-4-yl]amino]cyclopentyl]methanol |
| SMILES | C=CCc1sc(-c2c(C)nc(N)nc2NC2CCC(CO)C2)nc1/C=N/C |
| InChI | InChI=1S/C19H26N6OS/c1-4-5-15-14(9-21-3)24-18(27-15)16-11(2)22-19(20)25-17(16)23-13-7-6-12(8-13)10-26/h4,9,12-13,26H,1,5-8,10H2,2-3H3,(H3,20,22,23,25)/b21-9+ |
| InChIKey | SIIJEKYDZYEMHU-ZVBGSRNCSA-N |
| XLogP | 2.84 |
| TPSA | 109.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|