C20H26ClN5O2S — CID 143945834
4-[[5-(1,3-benzothiazol-2-yl)-6-chloro-2-(2-methoxyethylamino)pyrimidin-4-yl]amino]-2-ethylbutan-1-ol (PubChem CID 143945834) has the molecular formula C20H26ClN5O2S and a molecular weight of 435.98 g/mol. Its IUPAC name is 4-[[5-(1,3-benzothiazol-2-yl)-6-chloro-2-(2-methoxyethylamino)pyrimidin-4-yl]amino]-2-ethylbutan-1-ol.
| Compound Name | 4-[[5-(1,3-benzothiazol-2-yl)-6-chloro-2-(2-methoxyethylamino)pyrimidin-4-yl]amino]-2-ethylbutan-1-ol |
|---|---|
| PubChem CID | 143945834 |
| Molecular Formula | C20H26ClN5O2S |
| Molecular Weight | 435.98 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 4-[[5-(1,3-benzothiazol-2-yl)-6-chloro-2-(2-methoxyethylamino)pyrimidin-4-yl]amino]-2-ethylbutan-1-ol |
| SMILES | CCC(CO)CCNc1nc(NCCOC)nc(Cl)c1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H26ClN5O2S/c1-3-13(12-27)8-9-22-18-16(17(21)25-20(26-18)23-10-11-28-2)19-24-14-6-4-5-7-15(14)29-19/h4-7,13,27H,3,8-12H2,1-2H3,(H2,22,23,25,26) |
| InChIKey | SZQMGYRHDDWQEO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 92.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.98 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|