About N,3-dimethylbutan-2-amine;methane
N,3-dimethylbutan-2-amine;methane (PubChem CID 143946020) has the molecular formula C7H19N
and a molecular weight of 117.24 g/mol. Its IUPAC name is N,3-dimethylbutan-2-amine;methane.
Molecular Properties
| Compound Name | N,3-dimethylbutan-2-amine;methane |
| PubChem CID | 143946020 |
| Molecular Formula | C7H19N |
| Molecular Weight | 117.24 g/mol |
| Exact Mass | 117.15 |
| IUPAC Name | N,3-dimethylbutan-2-amine;methane |
| SMILES | C.CNC(C)C(C)C |
| InChI | InChI=1S/C6H15N.CH4/c1-5(2)6(3)7-4;/h5-7H,1-4H3;1H4 |
| InChIKey | RDHRZCWMSBOZEW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,3-dimethylbutan-2-amine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethylbutan-2-amine;methane?
The IUPAC name of N,3-dimethylbutan-2-amine;methane (CID 143946020) is N,3-dimethylbutan-2-amine;methane.
What is the SMILES notation for N,3-dimethylbutan-2-amine;methane?
The canonical SMILES for N,3-dimethylbutan-2-amine;methane is C.CNC(C)C(C)C.
What is the InChIKey of N,3-dimethylbutan-2-amine;methane?
The InChIKey is RDHRZCWMSBOZEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.CH4/c1-5(2)6(3)7-4;/h5-7H,1-4H3;1H4.
What are the key properties of N,3-dimethylbutan-2-amine;methane?
N,3-dimethylbutan-2-amine;methane has a molecular weight of 117.24 g/mol, XLogP of 1.89, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethylbutan-2-amine;methane is sourced from PubChem (CID 143946020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).