C22H36F3N5S — CID 143946559
4-N,6-dimethyl-5-[5-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazol-2-yl]-2-N-(2,2,2-trifluoroethyl)pyrimidine-2,4-diamine;ethane;pentane (PubChem CID 143946559) has the molecular formula C22H36F3N5S and a molecular weight of 459.63 g/mol. Its IUPAC name is 4-N,6-dimethyl-5-[5-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazol-2-yl]-2-N-(2,2,2-trifluoroethyl)pyrimidine-2,4-diamine;ethane;pentane.
| Compound Name | 4-N,6-dimethyl-5-[5-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazol-2-yl]-2-N-(2,2,2-trifluoroethyl)pyrimidine-2,4-diamine;ethane;pentane |
|---|---|
| PubChem CID | 143946559 |
| Molecular Formula | C22H36F3N5S |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 4-N,6-dimethyl-5-[5-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazol-2-yl]-2-N-(2,2,2-trifluoroethyl)pyrimidine-2,4-diamine;ethane;pentane |
| SMILES | C/C=C\c1nc(-c2c(C)nc(NCC(F)(F)F)nc2NC)sc1C.CC.CCCCC |
| InChI | InChI=1S/C15H18F3N5S.C5H12.C2H6/c1-5-6-10-9(3)24-13(22-10)11-8(2)21-14(23-12(11)19-4)20-7-15(16,17)18;1-3-5-4-2;1-2/h5-6H,7H2,1-4H3,(H2,19,20,21,23);3-5H2,1-2H3;1-2H3/b6-5-;; |
| InChIKey | ICVPNGSCWKIFOC-XNOMRPDFSA-N |
| XLogP | 7.49 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |