C34H39N5O8 — CID 143947163
4-[[2-[[2-[[(2R)-2-[[2-[[2-(4-methylphenoxy)acetyl]amino]acetyl]amino]-3-(4-phenylphenyl)propanoyl]amino]acetyl]amino]acetyl]amino]butanoic acid (PubChem CID 143947163) has the molecular formula C34H39N5O8 and a molecular weight of 645.71 g/mol. Its IUPAC name is 4-[[2-[[2-[[(2R)-2-[[2-[[2-(4-methylphenoxy)acetyl]amino]acetyl]amino]-3-(4-phenylphenyl)propanoyl]amino]acetyl]amino]acetyl]amino]butanoic acid.
| Compound Name | 4-[[2-[[2-[[(2R)-2-[[2-[[2-(4-methylphenoxy)acetyl]amino]acetyl]amino]-3-(4-phenylphenyl)propanoyl]amino]acetyl]amino]acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 143947163 |
| Molecular Formula | C34H39N5O8 |
| Molecular Weight | 645.71 g/mol |
| Exact Mass | 645.28 |
| IUPAC Name | 4-[[2-[[2-[[(2R)-2-[[2-[[2-(4-methylphenoxy)acetyl]amino]acetyl]amino]-3-(4-phenylphenyl)propanoyl]amino]acetyl]amino]acetyl]amino]butanoic acid |
| SMILES | Cc1ccc(OCC(=O)NCC(=O)N[C@H](Cc2ccc(-c3ccccc3)cc2)C(=O)NCC(=O)NCC(=O)NCCCC(=O)O)cc1 |
| InChI | InChI=1S/C34H39N5O8/c1-23-9-15-27(16-10-23)47-22-32(43)37-21-31(42)39-28(18-24-11-13-26(14-12-24)25-6-3-2-4-7-25)34(46)38-20-30(41)36-19-29(40)35-17-5-8-33(44)45/h2-4,6-7,9-16,28H,5,8,17-22H2,1H3,(H,35,40)(H,36,41)(H,37,43)(H,38,46)(H,39,42)(H,44,45)/t28-/m1/s1 |
| InChIKey | OVVWUOZKJXXRBC-MUUNZHRXSA-N |
| XLogP | 1.10 |
| TPSA | 192.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.71 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|