(2S)-2-methyl-4-phenylbutanamide;molecular hydrogen

C11H17NO — CID 143947472

IUPAC(2S)-2-methyl-4-phenylbutanamide;molecular hydrogen
SMILESC[C@@H](CCc1ccccc1)C(N)=O.[H][H]
InChIInChI=1S/C11H15NO.H2/c1-9(11(12)13)7-8-10-5-3-2-4-6-10;/h2-6,9H,7-8H2,1H3,(H2,12,13);1H/t9-;/m0./s1
InChIKeyQPWPHVWQUTZDMF-FVGYRXGTSA-N
MW179.26 g/mol
LogP1.99
Rot. Bonds4

About (2S)-2-methyl-4-phenylbutanamide;molecular hydrogen

(2S)-2-methyl-4-phenylbutanamide;molecular hydrogen (PubChem CID 143947472) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (2S)-2-methyl-4-phenylbutanamide;molecular hydrogen.

Molecular Properties

Compound Name(2S)-2-methyl-4-phenylbutanamide;molecular hydrogen
PubChem CID143947472
Molecular FormulaC11H17NO
Molecular Weight179.26 g/mol
Exact Mass179.13
IUPAC Name(2S)-2-methyl-4-phenylbutanamide;molecular hydrogen
SMILESC[C@@H](CCc1ccccc1)C(N)=O.[H][H]
InChIInChI=1S/C11H15NO.H2/c1-9(11(12)13)7-8-10-5-3-2-4-6-10;/h2-6,9H,7-8H2,1H3,(H2,12,13);1H/t9-;/m0./s1
InChIKeyQPWPHVWQUTZDMF-FVGYRXGTSA-N
XLogP1.99
TPSA43.09 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.26
LogP ≤ 51.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (2S)-2-methyl-4-phenylbutanamide;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-methyl-4-phenylbutanamide;molecular hydrogen?
The IUPAC name of (2S)-2-methyl-4-phenylbutanamide;molecular hydrogen (CID 143947472) is (2S)-2-methyl-4-phenylbutanamide;molecular hydrogen.
What is the SMILES notation for (2S)-2-methyl-4-phenylbutanamide;molecular hydrogen?
The canonical SMILES for (2S)-2-methyl-4-phenylbutanamide;molecular hydrogen is C[C@@H](CCc1ccccc1)C(N)=O.[H][H].
What is the InChIKey of (2S)-2-methyl-4-phenylbutanamide;molecular hydrogen?
The InChIKey is QPWPHVWQUTZDMF-FVGYRXGTSA-N. The full InChI is InChI=1S/C11H15NO.H2/c1-9(11(12)13)7-8-10-5-3-2-4-6-10;/h2-6,9H,7-8H2,1H3,(H2,12,13);1H/t9-;/m0./s1.
What are the key properties of (2S)-2-methyl-4-phenylbutanamide;molecular hydrogen?
(2S)-2-methyl-4-phenylbutanamide;molecular hydrogen has a molecular weight of 179.26 g/mol, XLogP of 1.99, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-methyl-4-phenylbutanamide;molecular hydrogen is sourced from PubChem (CID 143947472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).