C18H33N5O2S — CID 143948198
1-[6-(2-ethylpentoxyamino)sulfanylhexyl]-3-pyrimidin-4-ylurea (PubChem CID 143948198) has the molecular formula C18H33N5O2S and a molecular weight of 383.56 g/mol. Its IUPAC name is 1-[6-(2-ethylpentoxyamino)sulfanylhexyl]-3-pyrimidin-4-ylurea.
| Compound Name | 1-[6-(2-ethylpentoxyamino)sulfanylhexyl]-3-pyrimidin-4-ylurea |
|---|---|
| PubChem CID | 143948198 |
| Molecular Formula | C18H33N5O2S |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | 1-[6-(2-ethylpentoxyamino)sulfanylhexyl]-3-pyrimidin-4-ylurea |
| SMILES | CCCC(CC)CONSCCCCCCNC(=O)Nc1ccncn1 |
| InChI | InChI=1S/C18H33N5O2S/c1-3-9-16(4-2)14-25-23-26-13-8-6-5-7-11-20-18(24)22-17-10-12-19-15-21-17/h10,12,15-16,23H,3-9,11,13-14H2,1-2H3,(H2,19,20,21,22,24) |
| InChIKey | JKUXWEWHFBDZDI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|