About 1-ethenyl-1-ethyl-4-methyl-3,4-dihydroisochromene
1-ethenyl-1-ethyl-4-methyl-3,4-dihydroisochromene (PubChem CID 143948279) has the molecular formula C14H18O
and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-ethenyl-1-ethyl-4-methyl-3,4-dihydroisochromene.
Molecular Properties
| Compound Name | 1-ethenyl-1-ethyl-4-methyl-3,4-dihydroisochromene |
| PubChem CID | 143948279 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 1-ethenyl-1-ethyl-4-methyl-3,4-dihydroisochromene |
| SMILES | C=CC1(CC)OCC(C)c2ccccc21 |
| InChI | InChI=1S/C14H18O/c1-4-14(5-2)13-9-7-6-8-12(13)11(3)10-15-14/h4,6-9,11H,1,5,10H2,2-3H3 |
| InChIKey | IUSYFCBSDRQYNR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-1-ethyl-4-methyl-3,4-dihydroisochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-1-ethyl-4-methyl-3,4-dihydroisochromene?
The IUPAC name of 1-ethenyl-1-ethyl-4-methyl-3,4-dihydroisochromene (CID 143948279) is 1-ethenyl-1-ethyl-4-methyl-3,4-dihydroisochromene.
What is the SMILES notation for 1-ethenyl-1-ethyl-4-methyl-3,4-dihydroisochromene?
The canonical SMILES for 1-ethenyl-1-ethyl-4-methyl-3,4-dihydroisochromene is C=CC1(CC)OCC(C)c2ccccc21.
What is the InChIKey of 1-ethenyl-1-ethyl-4-methyl-3,4-dihydroisochromene?
The InChIKey is IUSYFCBSDRQYNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O/c1-4-14(5-2)13-9-7-6-8-12(13)11(3)10-15-14/h4,6-9,11H,1,5,10H2,2-3H3.
What are the key properties of 1-ethenyl-1-ethyl-4-methyl-3,4-dihydroisochromene?
1-ethenyl-1-ethyl-4-methyl-3,4-dihydroisochromene has a molecular weight of 202.30 g/mol, XLogP of 3.61, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-1-ethyl-4-methyl-3,4-dihydroisochromene is sourced from PubChem (CID 143948279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).