C36H40N2Si — CID 143948970
tri(propan-2-yl)-[2-(7,11,19-trimethyl-7,19-diazahexacyclo[11.11.0.02,10.04,8.014,22.016,20]tetracosa-1(13),2(10),3,5,8,11,14(22),15,17,20,23-undecaen-6-yl)ethynyl]silane (PubChem CID 143948970) has the molecular formula C36H40N2Si and a molecular weight of 528.82 g/mol. Its IUPAC name is tri(propan-2-yl)-[2-(7,11,19-trimethyl-7,19-diazahexacyclo[11.11.0.02,10.04,8.014,22.016,20]tetracosa-1(13),2(10),3,5,8,11,14(22),15,17,20,23-undecaen-6-yl)ethynyl]silane.
| Compound Name | tri(propan-2-yl)-[2-(7,11,19-trimethyl-7,19-diazahexacyclo[11.11.0.02,10.04,8.014,22.016,20]tetracosa-1(13),2(10),3,5,8,11,14(22),15,17,20,23-undecaen-6-yl)ethynyl]silane |
|---|---|
| PubChem CID | 143948970 |
| Molecular Formula | C36H40N2Si |
| Molecular Weight | 528.82 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | tri(propan-2-yl)-[2-(7,11,19-trimethyl-7,19-diazahexacyclo[11.11.0.02,10.04,8.014,22.016,20]tetracosa-1(13),2(10),3,5,8,11,14(22),15,17,20,23-undecaen-6-yl)ethynyl]silane |
| SMILES | Cc1cc2c3cc4ccn(C)c4cc3ccc2c2cc3cc(C#C[Si](C(C)C)(C(C)C)C(C)C)n(C)c3cc12 |
| InChI | InChI=1S/C36H40N2Si/c1-22(2)39(23(3)4,24(5)6)15-13-29-17-28-19-34-30-11-10-26-20-35-27(12-14-37(35)8)18-32(26)33(30)16-25(7)31(34)21-36(28)38(29)9/h10-12,14,16-24H,1-9H3 |
| InChIKey | ULEBGIPCOCDCMN-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.82 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|