C16H20N4O2S — CID 143950075
2-(methylamino)-4-(4-methyl-2-piperidin-1-ylpyrimidin-5-yl)thiophene-3-carboxylic acid (PubChem CID 143950075) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is 2-(methylamino)-4-(4-methyl-2-piperidin-1-ylpyrimidin-5-yl)thiophene-3-carboxylic acid.
| Compound Name | 2-(methylamino)-4-(4-methyl-2-piperidin-1-ylpyrimidin-5-yl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 143950075 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-(methylamino)-4-(4-methyl-2-piperidin-1-ylpyrimidin-5-yl)thiophene-3-carboxylic acid |
| SMILES | CNc1scc(-c2cnc(N3CCCCC3)nc2C)c1C(=O)O |
| InChI | InChI=1S/C16H20N4O2S/c1-10-11(12-9-23-14(17-2)13(12)15(21)22)8-18-16(19-10)20-6-4-3-5-7-20/h8-9,17H,3-7H2,1-2H3,(H,21,22) |
| InChIKey | XQRBAOVHNPZEHP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |