C25H32FNO3 — CID 143950414
(1R)-1-(4-ethynyl-2-fluorophenoxy)-2-methyl-2,3-dihydro-1H-indene-4,6-diol;heptan-3-amine (PubChem CID 143950414) has the molecular formula C25H32FNO3 and a molecular weight of 413.53 g/mol. Its IUPAC name is (1R)-1-(4-ethynyl-2-fluorophenoxy)-2-methyl-2,3-dihydro-1H-indene-4,6-diol;heptan-3-amine.
| Compound Name | (1R)-1-(4-ethynyl-2-fluorophenoxy)-2-methyl-2,3-dihydro-1H-indene-4,6-diol;heptan-3-amine |
|---|---|
| PubChem CID | 143950414 |
| Molecular Formula | C25H32FNO3 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | (1R)-1-(4-ethynyl-2-fluorophenoxy)-2-methyl-2,3-dihydro-1H-indene-4,6-diol;heptan-3-amine |
| SMILES | C#Cc1ccc(O[C@H]2c3cc(O)cc(O)c3CC2C)c(F)c1.CCCCC(N)CC |
| InChI | InChI=1S/C18H15FO3.C7H17N/c1-3-11-4-5-17(15(19)7-11)22-18-10(2)6-13-14(18)8-12(20)9-16(13)21;1-3-5-6-7(8)4-2/h1,4-5,7-10,18,20-21H,6H2,2H3;7H,3-6,8H2,1-2H3/t10?,18-;/m1./s1 |
| InChIKey | KUOHSWIYTXJHRV-SEWWGJLFSA-N |
| XLogP | 5.44 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|