C28H34N2 — CID 143950955
N,4-dimethyl-3-[4-[2-[(1S,2S)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]ethenyl]phenyl]pent-4-en-2-imine (PubChem CID 143950955) has the molecular formula C28H34N2 and a molecular weight of 398.59 g/mol. Its IUPAC name is N,4-dimethyl-3-[4-[2-[(1S,2S)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]ethenyl]phenyl]pent-4-en-2-imine.
| Compound Name | N,4-dimethyl-3-[4-[2-[(1S,2S)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]ethenyl]phenyl]pent-4-en-2-imine |
|---|---|
| PubChem CID | 143950955 |
| Molecular Formula | C28H34N2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | N,4-dimethyl-3-[4-[2-[(1S,2S)-2-pyrrolidin-1-yl-2,3-dihydro-1H-inden-1-yl]ethenyl]phenyl]pent-4-en-2-imine |
| SMILES | C=C(C)C(/C(C)=N/C)c1ccc(C=C[C@H]2c3ccccc3C[C@@H]2N2CCCC2)cc1 |
| InChI | InChI=1S/C28H34N2/c1-20(2)28(21(3)29-4)23-14-11-22(12-15-23)13-16-26-25-10-6-5-9-24(25)19-27(26)30-17-7-8-18-30/h5-6,9-16,26-28H,1,7-8,17-19H2,2-4H3/b16-13?,29-21+/t26-,27-,28?/m0/s1 |
| InChIKey | OULMYVDXOKJKEK-HHGKZMKJSA-N |
| XLogP | 6.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|