C27H28O — CID 143951001
1-[4-[2-[(1S,2S)-2-(cyclohexen-1-yl)-2,3-dihydro-1H-inden-1-yl]ethynyl]phenyl]butan-1-one (PubChem CID 143951001) has the molecular formula C27H28O and a molecular weight of 368.52 g/mol. Its IUPAC name is 1-[4-[2-[(1S,2S)-2-(cyclohexen-1-yl)-2,3-dihydro-1H-inden-1-yl]ethynyl]phenyl]butan-1-one.
| Compound Name | 1-[4-[2-[(1S,2S)-2-(cyclohexen-1-yl)-2,3-dihydro-1H-inden-1-yl]ethynyl]phenyl]butan-1-one |
|---|---|
| PubChem CID | 143951001 |
| Molecular Formula | C27H28O |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 1-[4-[2-[(1S,2S)-2-(cyclohexen-1-yl)-2,3-dihydro-1H-inden-1-yl]ethynyl]phenyl]butan-1-one |
| SMILES | CCCC(=O)c1ccc(C#C[C@H]2c3ccccc3C[C@@H]2C2=CCCCC2)cc1 |
| InChI | InChI=1S/C27H28O/c1-2-8-27(28)22-16-13-20(14-17-22)15-18-25-24-12-7-6-11-23(24)19-26(25)21-9-4-3-5-10-21/h6-7,9,11-14,16-17,25-26H,2-5,8,10,19H2,1H3/t25-,26+/m0/s1 |
| InChIKey | KPAUNTYTVADAMI-IZZNHLLZSA-N |
| XLogP | 6.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|