C27H26F2N4O3 — CID 143951725
N-[4-[(1R,4R)-3-ethenyl-4-hydroxy-5-methanimidoylcyclohexyl]-3-pyridinyl]-5-fluoro-6-(2-fluoro-4-hydroxy-6-methylphenyl)pyridine-2-carboxamide (PubChem CID 143951725) has the molecular formula C27H26F2N4O3 and a molecular weight of 492.53 g/mol. Its IUPAC name is N-[4-[(1R,4R)-3-ethenyl-4-hydroxy-5-methanimidoylcyclohexyl]-3-pyridinyl]-5-fluoro-6-(2-fluoro-4-hydroxy-6-methylphenyl)pyridine-2-carboxamide.
| Compound Name | N-[4-[(1R,4R)-3-ethenyl-4-hydroxy-5-methanimidoylcyclohexyl]-3-pyridinyl]-5-fluoro-6-(2-fluoro-4-hydroxy-6-methylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 143951725 |
| Molecular Formula | C27H26F2N4O3 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | N-[4-[(1R,4R)-3-ethenyl-4-hydroxy-5-methanimidoylcyclohexyl]-3-pyridinyl]-5-fluoro-6-(2-fluoro-4-hydroxy-6-methylphenyl)pyridine-2-carboxamide |
| SMILES | [H]/N=C/C1C[C@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(C)cc(O)cc3F)n2)CC(C=C)[C@H]1O |
| InChI | InChI=1S/C27H26F2N4O3/c1-3-15-9-16(10-17(12-30)26(15)35)19-6-7-31-13-23(19)33-27(36)22-5-4-20(28)25(32-22)24-14(2)8-18(34)11-21(24)29/h3-8,11-13,15-17,26,30,34-35H,1,9-10H2,2H3,(H,33,36)/b30-12+/t15?,16-,17?,26-/m1/s1 |
| InChIKey | FWNIGGDYXDZASA-SLUKZGDVSA-N |
| XLogP | 4.99 |
| TPSA | 119.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|