C24H35N6O2S+ — CID 143951938
ethane;hydroxy-[6-[(4-morpholin-4-ylphenyl)methylamino]-3-pyridinyl]-[(1,3,5-trimethylpyrazol-4-yl)amino]sulfanium (PubChem CID 143951938) has the molecular formula C24H35N6O2S+ and a molecular weight of 471.65 g/mol. Its IUPAC name is ethane;hydroxy-[6-[(4-morpholin-4-ylphenyl)methylamino]-3-pyridinyl]-[(1,3,5-trimethylpyrazol-4-yl)amino]sulfanium.
| Compound Name | ethane;hydroxy-[6-[(4-morpholin-4-ylphenyl)methylamino]-3-pyridinyl]-[(1,3,5-trimethylpyrazol-4-yl)amino]sulfanium |
|---|---|
| PubChem CID | 143951938 |
| Molecular Formula | C24H35N6O2S+ |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | ethane;hydroxy-[6-[(4-morpholin-4-ylphenyl)methylamino]-3-pyridinyl]-[(1,3,5-trimethylpyrazol-4-yl)amino]sulfanium |
| SMILES | CC.Cc1nn(C)c(C)c1N[S+](O)c1ccc(NCc2ccc(N3CCOCC3)cc2)nc1 |
| InChI | InChI=1S/C22H29N6O2S.C2H6/c1-16-22(17(2)27(3)25-16)26-31(29)20-8-9-21(24-15-20)23-14-18-4-6-19(7-5-18)28-10-12-30-13-11-28;1-2/h4-9,15,26,29H,10-14H2,1-3H3,(H,23,24);1-2H3/q+1; |
| InChIKey | HGLCKGZRQRMKHX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|