About CID 143951959
CID 143951959 (PubChem CID 143951959) has the molecular formula C24H33N4O2S+
and a molecular weight of 441.62 g/mol.
Molecular Properties
| Compound Name | CID 143951959 |
| PubChem CID | 143951959 |
| Molecular Formula | C24H33N4O2S+ |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | — |
| SMILES | CCNCc1cccc(-c2ccc([S+](=O)(O)Nc3c(CC(C)C)nn(C)c3C)cc2)c1 |
| InChI | InChI=1S/C24H32N4O2S/c1-6-25-16-19-8-7-9-21(15-19)20-10-12-22(13-11-20)31(29,30)27-24-18(4)28(5)26-23(24)14-17(2)3/h7-13,15,17,25H,6,14,16H2,1-5H3,(H-,27,29,30)/p+1 |
| InChIKey | IYIKJWZFZWCRRP-UHFFFAOYSA-O |
| XLogP | 5.06 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 143951959 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143951959?
The IUPAC name of CID 143951959 (CID 143951959) is not available.
What is the SMILES notation for CID 143951959?
The canonical SMILES for CID 143951959 is CCNCc1cccc(-c2ccc([S+](=O)(O)Nc3c(CC(C)C)nn(C)c3C)cc2)c1.
What is the InChIKey of CID 143951959?
The InChIKey is IYIKJWZFZWCRRP-UHFFFAOYSA-O. The full InChI is InChI=1S/C24H32N4O2S/c1-6-25-16-19-8-7-9-21(15-19)20-10-12-22(13-11-20)31(29,30)27-24-18(4)28(5)26-23(24)14-17(2)3/h7-13,15,17,25H,6,14,16H2,1-5H3,(H-,27,29,30)/p+1.
What are the key properties of CID 143951959?
CID 143951959 has a molecular weight of 441.62 g/mol, XLogP of 5.06, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143951959 is sourced from PubChem (CID 143951959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).