C17H26O — CID 143952419
2,3-ditert-butyl-2,3-dihydro-1H-inden-5-ol (PubChem CID 143952419) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 2,3-ditert-butyl-2,3-dihydro-1H-inden-5-ol.
| Compound Name | 2,3-ditert-butyl-2,3-dihydro-1H-inden-5-ol |
|---|---|
| PubChem CID | 143952419 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 2,3-ditert-butyl-2,3-dihydro-1H-inden-5-ol |
| SMILES | CC(C)(C)C1Cc2ccc(O)cc2C1C(C)(C)C |
| InChI | InChI=1S/C17H26O/c1-16(2,3)14-9-11-7-8-12(18)10-13(11)15(14)17(4,5)6/h7-8,10,14-15,18H,9H2,1-6H3 |
| InChIKey | MVYCPFKUDGPAKY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |