About 2,3-ditert-butyl-2,3-dihydro-1H-inden-5-ol
2,3-ditert-butyl-2,3-dihydro-1H-inden-5-ol (PubChem CID 143952419) has the molecular formula C17H26O
and a molecular weight of 246.39 g/mol. Its IUPAC name is 2,3-ditert-butyl-2,3-dihydro-1H-inden-5-ol.
Molecular Properties
| Compound Name | 2,3-ditert-butyl-2,3-dihydro-1H-inden-5-ol |
| PubChem CID | 143952419 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 2,3-ditert-butyl-2,3-dihydro-1H-inden-5-ol |
| SMILES | CC(C)(C)C1Cc2ccc(O)cc2C1C(C)(C)C |
| InChI | InChI=1S/C17H26O/c1-16(2,3)14-9-11-7-8-12(18)10-13(11)15(14)17(4,5)6/h7-8,10,14-15,18H,9H2,1-6H3 |
| InChIKey | MVYCPFKUDGPAKY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-ditert-butyl-2,3-dihydro-1H-inden-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-ditert-butyl-2,3-dihydro-1H-inden-5-ol?
The IUPAC name of 2,3-ditert-butyl-2,3-dihydro-1H-inden-5-ol (CID 143952419) is 2,3-ditert-butyl-2,3-dihydro-1H-inden-5-ol.
What is the SMILES notation for 2,3-ditert-butyl-2,3-dihydro-1H-inden-5-ol?
The canonical SMILES for 2,3-ditert-butyl-2,3-dihydro-1H-inden-5-ol is CC(C)(C)C1Cc2ccc(O)cc2C1C(C)(C)C.
What is the InChIKey of 2,3-ditert-butyl-2,3-dihydro-1H-inden-5-ol?
The InChIKey is MVYCPFKUDGPAKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O/c1-16(2,3)14-9-11-7-8-12(18)10-13(11)15(14)17(4,5)6/h7-8,10,14-15,18H,9H2,1-6H3.
What are the key properties of 2,3-ditert-butyl-2,3-dihydro-1H-inden-5-ol?
2,3-ditert-butyl-2,3-dihydro-1H-inden-5-ol has a molecular weight of 246.39 g/mol, XLogP of 4.74, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-ditert-butyl-2,3-dihydro-1H-inden-5-ol is sourced from PubChem (CID 143952419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).