C69H49N3O — CID 143952644
benzenecarboximidoyl 4-[2-[2-[4-(N-[4-(9,9-diphenylfluoren-2-yl)phenyl]anilino)phenyl]phenyl]phenyl]benzenecarboximidate (PubChem CID 143952644) has the molecular formula C69H49N3O and a molecular weight of 936.17 g/mol. Its IUPAC name is benzenecarboximidoyl 4-[2-[2-[4-(N-[4-(9,9-diphenylfluoren-2-yl)phenyl]anilino)phenyl]phenyl]phenyl]benzenecarboximidate.
| Compound Name | benzenecarboximidoyl 4-[2-[2-[4-(N-[4-(9,9-diphenylfluoren-2-yl)phenyl]anilino)phenyl]phenyl]phenyl]benzenecarboximidate |
|---|---|
| PubChem CID | 143952644 |
| Molecular Formula | C69H49N3O |
| Molecular Weight | 936.17 g/mol |
| Exact Mass | 935.39 |
| IUPAC Name | benzenecarboximidoyl 4-[2-[2-[4-(N-[4-(9,9-diphenylfluoren-2-yl)phenyl]anilino)phenyl]phenyl]phenyl]benzenecarboximidate |
| SMILES | [H]/N=C(\O/C(=N/[H])c1ccccc1)c1ccc(-c2ccccc2-c2ccccc2-c2ccc(N(c3ccccc3)c3ccc(-c4ccc5c(c4)C(c4ccccc4)(c4ccccc4)c4ccccc4-5)cc3)cc2)cc1 |
| InChI | InChI=1S/C69H49N3O/c70-67(51-19-5-1-6-20-51)73-68(71)52-35-33-49(34-36-52)59-27-13-15-29-61(59)62-30-16-14-28-60(62)50-39-44-58(45-40-50)72(56-25-11-4-12-26-56)57-42-37-48(38-43-57)53-41-46-64-63-31-17-18-32-65(63)69(66(64)47-53,54-21-7-2-8-22-54)55-23-9-3-10-24-55/h1-47,70-71H/b70-67+,71-68- |
| InChIKey | HSFKAIVSIRJNTB-MDDIYAITSA-N |
| XLogP | 17.56 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 936.17 |
| LogP ≤ 5 | 17.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|