C20H27F3N8S — CID 143953420
4-[2-(4-methylpiperazin-1-yl)-6-propylthieno[2,3-d]pyrimidin-4-yl]-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine (PubChem CID 143953420) has the molecular formula C20H27F3N8S and a molecular weight of 468.55 g/mol. Its IUPAC name is 4-[2-(4-methylpiperazin-1-yl)-6-propylthieno[2,3-d]pyrimidin-4-yl]-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine.
| Compound Name | 4-[2-(4-methylpiperazin-1-yl)-6-propylthieno[2,3-d]pyrimidin-4-yl]-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine |
|---|---|
| PubChem CID | 143953420 |
| Molecular Formula | C20H27F3N8S |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | 4-[2-(4-methylpiperazin-1-yl)-6-propylthieno[2,3-d]pyrimidin-4-yl]-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine |
| SMILES | [H]/N=C1\CN(c2nc(N3CCN(C)CC3)nc3sc(CCC)cc23)CCN1/C(=N/[H])C(F)(F)F |
| InChI | InChI=1S/C20H27F3N8S/c1-3-4-13-11-14-16(30-9-10-31(15(24)12-30)18(25)20(21,22)23)26-19(27-17(14)32-13)29-7-5-28(2)6-8-29/h11,24-25H,3-10,12H2,1-2H3/b24-15+,25-18+ |
| InChIKey | LNEOVHVOECPOAG-NZCNRJORSA-N |
| XLogP | 3.03 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|