C21H22F3N7OS — CID 143953461
4-[6-propyl-2-(pyridin-2-ylmethoxy)thieno[2,3-d]pyrimidin-4-yl]-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine (PubChem CID 143953461) has the molecular formula C21H22F3N7OS and a molecular weight of 477.52 g/mol. Its IUPAC name is 4-[6-propyl-2-(pyridin-2-ylmethoxy)thieno[2,3-d]pyrimidin-4-yl]-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine.
| Compound Name | 4-[6-propyl-2-(pyridin-2-ylmethoxy)thieno[2,3-d]pyrimidin-4-yl]-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine |
|---|---|
| PubChem CID | 143953461 |
| Molecular Formula | C21H22F3N7OS |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | 4-[6-propyl-2-(pyridin-2-ylmethoxy)thieno[2,3-d]pyrimidin-4-yl]-1-(2,2,2-trifluoroethanimidoyl)piperazin-2-imine |
| SMILES | [H]/N=C1\CN(c2nc(OCc3ccccn3)nc3sc(CCC)cc23)CCN1/C(=N/[H])C(F)(F)F |
| InChI | InChI=1S/C21H22F3N7OS/c1-2-5-14-10-15-17(30-8-9-31(16(25)11-30)19(26)21(22,23)24)28-20(29-18(15)33-14)32-12-13-6-3-4-7-27-13/h3-4,6-7,10,25-26H,2,5,8-9,11-12H2,1H3/b25-16+,26-19+ |
| InChIKey | GSNISADNPFSKIU-HYLYWPIHSA-N |
| XLogP | 4.26 |
| TPSA | 102.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|