About 4-amino-2,2-dimethylbutanal;anisole
4-amino-2,2-dimethylbutanal;anisole (PubChem CID 143953540) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is 4-amino-2,2-dimethylbutanal;anisole.
Molecular Properties
| Compound Name | 4-amino-2,2-dimethylbutanal;anisole |
| PubChem CID | 143953540 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 4-amino-2,2-dimethylbutanal;anisole |
| SMILES | CC(C)(C=O)CCN.COc1ccccc1 |
| InChI | InChI=1S/C7H8O.C6H13NO/c1-8-7-5-3-2-4-6-7;1-6(2,5-8)3-4-7/h2-6H,1H3;5H,3-4,7H2,1-2H3 |
| InChIKey | SEWLVYJCORCTQV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2,2-dimethylbutanal;anisole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,2-dimethylbutanal;anisole?
The IUPAC name of 4-amino-2,2-dimethylbutanal;anisole (CID 143953540) is 4-amino-2,2-dimethylbutanal;anisole.
What is the SMILES notation for 4-amino-2,2-dimethylbutanal;anisole?
The canonical SMILES for 4-amino-2,2-dimethylbutanal;anisole is CC(C)(C=O)CCN.COc1ccccc1.
What is the InChIKey of 4-amino-2,2-dimethylbutanal;anisole?
The InChIKey is SEWLVYJCORCTQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O.C6H13NO/c1-8-7-5-3-2-4-6-7;1-6(2,5-8)3-4-7/h2-6H,1H3;5H,3-4,7H2,1-2H3.
What are the key properties of 4-amino-2,2-dimethylbutanal;anisole?
4-amino-2,2-dimethylbutanal;anisole has a molecular weight of 223.32 g/mol, XLogP of 2.26, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,2-dimethylbutanal;anisole is sourced from PubChem (CID 143953540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).