C15H22O4 — CID 14395384
3-[2-(2-phenylmethoxyethyl)-1,3-dioxolan-2-yl]propan-1-ol (PubChem CID 14395384) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-[2-(2-phenylmethoxyethyl)-1,3-dioxolan-2-yl]propan-1-ol.
| Compound Name | 3-[2-(2-phenylmethoxyethyl)-1,3-dioxolan-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 14395384 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 3-[2-(2-phenylmethoxyethyl)-1,3-dioxolan-2-yl]propan-1-ol |
| SMILES | OCCCC1(CCOCc2ccccc2)OCCO1 |
| InChI | InChI=1S/C15H22O4/c16-9-4-7-15(18-11-12-19-15)8-10-17-13-14-5-2-1-3-6-14/h1-3,5-6,16H,4,7-13H2 |
| InChIKey | SZDJZRZAMXPLOD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|