C16H17ClN2O3S2 — CID 143954718
N-[(3S,4S)-1-chloro-4-sulfanylpyrrolidin-3-yl]-4-phenoxybenzenesulfonamide (PubChem CID 143954718) has the molecular formula C16H17ClN2O3S2 and a molecular weight of 384.91 g/mol. Its IUPAC name is N-[(3S,4S)-1-chloro-4-sulfanylpyrrolidin-3-yl]-4-phenoxybenzenesulfonamide.
| Compound Name | N-[(3S,4S)-1-chloro-4-sulfanylpyrrolidin-3-yl]-4-phenoxybenzenesulfonamide |
|---|---|
| PubChem CID | 143954718 |
| Molecular Formula | C16H17ClN2O3S2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | N-[(3S,4S)-1-chloro-4-sulfanylpyrrolidin-3-yl]-4-phenoxybenzenesulfonamide |
| SMILES | O=S(=O)(N[C@H]1CN(Cl)C[C@@H]1S)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C16H17ClN2O3S2/c17-19-10-15(16(23)11-19)18-24(20,21)14-8-6-13(7-9-14)22-12-4-2-1-3-5-12/h1-9,15-16,18,23H,10-11H2/t15-,16-/m0/s1 |
| InChIKey | YBFRNLXGZRBSEJ-HOTGVXAUSA-N |
| XLogP | 2.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|