About 3-amino-1-[3-(5,5-difluoro-2-methylheptyl)sulfanylphenyl]propan-1-ol
3-amino-1-[3-(5,5-difluoro-2-methylheptyl)sulfanylphenyl]propan-1-ol (PubChem CID 143954780) has the molecular formula C17H27F2NOS
and a molecular weight of 331.47 g/mol. Its IUPAC name is 3-amino-1-[3-(5,5-difluoro-2-methylheptyl)sulfanylphenyl]propan-1-ol.
Molecular Properties
| Compound Name | 3-amino-1-[3-(5,5-difluoro-2-methylheptyl)sulfanylphenyl]propan-1-ol |
| PubChem CID | 143954780 |
| Molecular Formula | C17H27F2NOS |
| Molecular Weight | 331.47 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 3-amino-1-[3-(5,5-difluoro-2-methylheptyl)sulfanylphenyl]propan-1-ol |
| SMILES | CCC(F)(F)CCC(C)CSc1cccc(C(O)CCN)c1 |
| InChI | InChI=1S/C17H27F2NOS/c1-3-17(18,19)9-7-13(2)12-22-15-6-4-5-14(11-15)16(21)8-10-20/h4-6,11,13,16,21H,3,7-10,12,20H2,1-2H3 |
| InChIKey | MBAHMWXCOCWWKR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-1-[3-(5,5-difluoro-2-methylheptyl)sulfanylphenyl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-[3-(5,5-difluoro-2-methylheptyl)sulfanylphenyl]propan-1-ol?
The IUPAC name of 3-amino-1-[3-(5,5-difluoro-2-methylheptyl)sulfanylphenyl]propan-1-ol (CID 143954780) is 3-amino-1-[3-(5,5-difluoro-2-methylheptyl)sulfanylphenyl]propan-1-ol.
What is the SMILES notation for 3-amino-1-[3-(5,5-difluoro-2-methylheptyl)sulfanylphenyl]propan-1-ol?
The canonical SMILES for 3-amino-1-[3-(5,5-difluoro-2-methylheptyl)sulfanylphenyl]propan-1-ol is CCC(F)(F)CCC(C)CSc1cccc(C(O)CCN)c1.
What is the InChIKey of 3-amino-1-[3-(5,5-difluoro-2-methylheptyl)sulfanylphenyl]propan-1-ol?
The InChIKey is MBAHMWXCOCWWKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27F2NOS/c1-3-17(18,19)9-7-13(2)12-22-15-6-4-5-14(11-15)16(21)8-10-20/h4-6,11,13,16,21H,3,7-10,12,20H2,1-2H3.
What are the key properties of 3-amino-1-[3-(5,5-difluoro-2-methylheptyl)sulfanylphenyl]propan-1-ol?
3-amino-1-[3-(5,5-difluoro-2-methylheptyl)sulfanylphenyl]propan-1-ol has a molecular weight of 331.47 g/mol, XLogP of 4.62, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-[3-(5,5-difluoro-2-methylheptyl)sulfanylphenyl]propan-1-ol is sourced from PubChem (CID 143954780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).