C16H27NOS — CID 143954897
2-[(1E,3E,5Z)-3-(cyclohexylmethylsulfanyl)hepta-1,3,5-trienoxy]ethanamine (PubChem CID 143954897) has the molecular formula C16H27NOS and a molecular weight of 281.47 g/mol. Its IUPAC name is 2-[(1E,3E,5Z)-3-(cyclohexylmethylsulfanyl)hepta-1,3,5-trienoxy]ethanamine.
| Compound Name | 2-[(1E,3E,5Z)-3-(cyclohexylmethylsulfanyl)hepta-1,3,5-trienoxy]ethanamine |
|---|---|
| PubChem CID | 143954897 |
| Molecular Formula | C16H27NOS |
| Molecular Weight | 281.47 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | 2-[(1E,3E,5Z)-3-(cyclohexylmethylsulfanyl)hepta-1,3,5-trienoxy]ethanamine |
| SMILES | C/C=C\C=C(/C=C/OCCN)SCC1CCCCC1 |
| InChI | InChI=1S/C16H27NOS/c1-2-3-9-16(10-12-18-13-11-17)19-14-15-7-5-4-6-8-15/h2-3,9-10,12,15H,4-8,11,13-14,17H2,1H3/b3-2-,12-10+,16-9+ |
| InChIKey | PHYBSWKAFLXEQC-HZMLIMCNSA-N |
| XLogP | 4.25 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|